Overview of Mild Surfactants on personal care CAS 40754-59-4 Disodium laureth sulfosuccinate
Surfactants, short for surface-active agents, are compounds that lower the surface tension between two liquids or between a liquid and a solid. They play a crucial role in various industries due to their unique ability to interact with interfaces, enhancing emulsification, dispersion, wetting, foaming, and detergency properties.
Surfactants typically have an amphiphilic nature, meaning they consist of both hydrophilic (water-loving) and hydrophobic (water-repellent) parts. This dual nature enables them to orient themselves at the interface between water and other substances, reducing the interfacial tension. The hydrophilic part is usually polar and often contains oxygen, nitrogen, or sulfur atoms, while the hydrophobic part is typically a long hydrocarbon chain.
Functions of Mild Surfactants on personal care CAS 40754-59-4 Disodium laureth sulfosuccinate
- Emulsification: By reducing the interfacial tension, surfactants facilitate the formation and stabilization of emulsions, where one liquid is dispersed in another immiscible liquid.
- Detergency: They help remove dirt and oils from surfaces by lowering the surface tension of water, allowing it to penetrate better into fabrics or surfaces, and by solubilizing greasy substances.
- Wetting: Surfactants speed up the wetting process by reducing the contact angle between a liquid and a solid, enhancing spreading.
- Foaming and Anti-Foaming: Depending on the type, surfactants can either stabilize foam (as in shampoo and soap) or break it down (in industrial processes where foam is undesirable).
- Dispersing Agent: They keep particles suspended in a liquid medium, preventing aggregation and settling.
Applications of Mild Surfactants on personal care CAS 40754-59-4 Disodium laureth sulfosuccinate
- Household and Industrial Cleaning Products: Detergents, soaps, and cleaning agents all rely on surfactants to remove dirt and grease.
- Personal Care and Cosmetics: Shampoos, conditioners, toothpaste, and skincare products use surfactants for cleansing, foaming, and emulsifying.
- Textile and Leather Processing: In textile manufacturing, surfactants assist in dyeing, finishing, and fabric softening.
- Agriculture: As adjuvants in pesticides and herbicides, surfactants improve the spreading and sticking of these chemicals to plant surfaces.
- Food Industry: Used as emulsifiers in foods like mayonnaise, ice cream, and salad dressings to stabilize mixtures.
- Oil Recovery and Environmental Remediation: Surfactants can enhance oil recovery in petroleum extraction and aid in the cleanup of oil spills.
(Mild Surfactants on personal care CAS 40754-59-4 Disodium laureth sulfosuccinate)
Parameters of Mild Surfactants on personal care CAS 40754-59-4 Disodium laureth sulfosuccinate
CAS Number: 40754-59-4
Ingredient: Disodium Laureth Sulfosuccinate
Parameter:
1. Chemical Name: Disodium laureth sulfosuccinate is an anionic surfactant, also known as sodium lauryl ether sulfosuccinate or AES (Allyl Ethyl Stearyl Sulfosuccinate).
2. Structure: It is derived from ethoxylated lauric acid and contains a succinic acid group, making it a sulfate ester with a mixed alcohol chain. The chemical formula is C12H25O3Na2(SO3)CH2CH2CH2OSO3Na.
3. Functionality: In personal care products, it acts as a primary surfactant, providing excellent foaming properties, emulsifying ability, and mild cleansing action. It is suitable for a wide range of applications, including shampoos, body washes, soaps, and toothpaste.
4. Safety and Regulatory Information: It is generally considered safe for use in cosmetic and personal care products, but like all ingredients, it should be used within the recommended concentration to avoid skin irritation. It is non-toxic, biodegradable, and environmentally friendly.
5. pH Compatibility: Disodium laureth sulfosuccinate has a neutral to slightly alkaline pH, which helps maintain a balanced pH level in formulations without causing skin irritation.
6. Performance: It is known for its good compatibility with other ingredients, low irritation potential, and effectiveness in removing oils and dirt from the skin and hair.
7. Environmental Impact: It is considered a more eco-friendly alternative to traditional linear alkylbenzene sulfonates (LAS), as it breaks down faster in water and has a lower persistence in the environment.
8. Concentration: Personal care products may use disodium laureth sulfosuccinate at concentrations ranging from 5% to 30%, depending on the desired properties and formulation requirements.
Remember that this information is a general overview, and specific product formulations may require additional adjustments based on factors such as pH, stability, and desired end-use properties.
(Mild Surfactants on personal care CAS 40754-59-4 Disodium laureth sulfosuccinate)
Company Profile
Surfactant China is a trusted global chemical material supplier & manufacturer with over 12-year-experience in providing super high-quality surfactant materials and relatives products.
The company has a professional technical department and Quality Supervision Department, a well-equipped laboratory, and equipped with advanced testing equipment and after-sales customer service center.
If you are looking for high-quality surfactants and relative products, please feel free to contact us or click on the needed products to send an inquiry.
Payment Methods
L/C, T/T, Western Union, Paypal, Credit Card etc.
Shipment
It could be shipped by sea, by air, or by reveal ASAP as soon as repayment receipt.
FAQs of Mild Surfactants on personal care CAS 40754-59-4 Disodium laureth sulfosuccinate
Q1. What exactly do Mild Surfactants on personal care CAS 40754-59-4 Disodium laureth sulfosuccinate do?
A: Mild Surfactants on personal care CAS 40754-59-4 Disodium laureth sulfosuccinate lower the surface tension between fluids or between a fluid and a solid, improving properties such as wetting, foaming, detergency, emulsification, and dispersing. They achieve this through their amphiphilic structure, which allows them to interact effectively at interfaces.
Q2. Are surfactants safe for the environment?
A: The environmental impact of Mild Surfactants on personal care CAS 40754-59-4 Disodium laureth sulfosuccinate varies greatly depending on their type, concentration, and the specific environment they enter. Some surfactants are biodegradable and pose minimal risk when used and disposed of properly. However, non-biodegradable surfactants can accumulate and harm aquatic life. It’s essential to choose eco-friendly options and follow recommended disposal guidelines.
Q3. How do Mild Surfactants on personal care CAS 40754-59-4 Disodium laureth sulfosuccinate affect skin and hair?
A: Mild Surfactants on personal care CAS 40754-59-4 Disodium laureth sulfosuccinate in personal care products can have both positive and negative effects. They help clean by removing dirt and oil but may also strip natural oils from the skin and hair, leading to dryness or irritation. Mild or moisturizing surfactants are often used in formulations to minimize these side effects.
Q4. How do Mild Surfactants on personal care CAS 40754-59-4 Disodium laureth sulfosuccinate contribute to the effectiveness of cleaning products?
A: In cleaning products, Mild Surfactants on personal care CAS 40754-59-4 Disodium laureth sulfosuccinate work by surrounding dirt particles, making them more soluble in water. They also reduce the surface tension of water, enabling it to penetrate better into fabrics and surfaces, and lift away grease and grime. This dual action of solubilization and penetration significantly enhances cleaning efficiency.
Q5. Why do some surfactants produce more foam than others?
A: The foaming capacity of surfactants depends on their molecular structure and the solution conditions. Generally, surfactants with long hydrocarbon chains and high concentrations tend to produce more stable foam because they can trap air more effectively. Additionally, anionic and nonionic surfactants are often associated with good foaming properties compared to cationic ones.
Q7. How do you determine the right surfactant for a specific application?
A: Choosing the right surfactant involves considering factors such as the required function (e.g., cleaning, emulsifying, wetting), compatibility with other ingredients in the formulation, environmental and safety regulations, cost-effectiveness, and desired end-product properties. Testing different surfactants in small-scale experiments is often necessary to identify the optimal choice for a given application.
(Mild Surfactants on personal care CAS 40754-59-4 Disodium laureth sulfosuccinate)